C8H11F3N2 — CID 142933118
(E)-N-methyl-1-(1,1,1-trifluorobut-3-en-2-ylideneamino)prop-1-en-2-amine (PubChem CID 142933118) has the molecular formula C8H11F3N2 and a molecular weight of 192.18 g/mol. Its IUPAC name is (E)-N-methyl-1-(1,1,1-trifluorobut-3-en-2-ylideneamino)prop-1-en-2-amine.
| Compound Name | (E)-N-methyl-1-(1,1,1-trifluorobut-3-en-2-ylideneamino)prop-1-en-2-amine |
|---|---|
| PubChem CID | 142933118 |
| Molecular Formula | C8H11F3N2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (E)-N-methyl-1-(1,1,1-trifluorobut-3-en-2-ylideneamino)prop-1-en-2-amine |
| SMILES | C=C/C(=N\C=C(/C)NC)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2/c1-4-7(8(9,10)11)13-5-6(2)12-3/h4-5,12H,1H2,2-3H3/b6-5+,13-7+ |
| InChIKey | UIGUHJKEJASFBK-WOXAVFRBSA-N |
| XLogP | 2.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|