C20H21N3O5S — CID 142937409
methyl 6-[3-[[amino(ethenylsulfanyl)methylidene]carbamoyl]-5-propan-2-yloxyphenoxy]pyridine-3-carboxylate (PubChem CID 142937409) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is methyl 6-[3-[[amino(ethenylsulfanyl)methylidene]carbamoyl]-5-propan-2-yloxyphenoxy]pyridine-3-carboxylate.
| Compound Name | methyl 6-[3-[[amino(ethenylsulfanyl)methylidene]carbamoyl]-5-propan-2-yloxyphenoxy]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 142937409 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | methyl 6-[3-[[amino(ethenylsulfanyl)methylidene]carbamoyl]-5-propan-2-yloxyphenoxy]pyridine-3-carboxylate |
| SMILES | C=CS/C(N)=N\C(=O)c1cc(Oc2ccc(C(=O)OC)cn2)cc(OC(C)C)c1 |
| InChI | InChI=1S/C20H21N3O5S/c1-5-29-20(21)23-18(24)14-8-15(27-12(2)3)10-16(9-14)28-17-7-6-13(11-22-17)19(25)26-4/h5-12H,1H2,2-4H3,(H2,21,23,24) |
| InChIKey | DXKMQCWVXCACTD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|