C13H16N2O2S2 — CID 142937402
ethenyl N'-(3-propan-2-yloxy-5-sulfanylbenzoyl)carbamimidothioate (PubChem CID 142937402) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is ethenyl N'-(3-propan-2-yloxy-5-sulfanylbenzoyl)carbamimidothioate.
| Compound Name | ethenyl N'-(3-propan-2-yloxy-5-sulfanylbenzoyl)carbamimidothioate |
|---|---|
| PubChem CID | 142937402 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | ethenyl N'-(3-propan-2-yloxy-5-sulfanylbenzoyl)carbamimidothioate |
| SMILES | C=CS/C(N)=N\C(=O)c1cc(S)cc(OC(C)C)c1 |
| InChI | InChI=1S/C13H16N2O2S2/c1-4-19-13(14)15-12(16)9-5-10(17-8(2)3)7-11(18)6-9/h4-8,18H,1H2,2-3H3,(H2,14,15,16) |
| InChIKey | IZFIDCYXXQMLLU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|