C21H24N4O6S2 — CID 142937408
[(E)-2-aminoethenyl] N'-[3-[1-(methylamino)-1-oxopropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)benzoyl]carbamimidothioate (PubChem CID 142937408) has the molecular formula C21H24N4O6S2 and a molecular weight of 492.58 g/mol. Its IUPAC name is [(E)-2-aminoethenyl] N'-[3-[1-(methylamino)-1-oxopropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)benzoyl]carbamimidothioate.
| Compound Name | [(E)-2-aminoethenyl] N'-[3-[1-(methylamino)-1-oxopropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)benzoyl]carbamimidothioate |
|---|---|
| PubChem CID | 142937408 |
| Molecular Formula | C21H24N4O6S2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | [(E)-2-aminoethenyl] N'-[3-[1-(methylamino)-1-oxopropan-2-yl]oxy-5-(4-methylsulfonylphenoxy)benzoyl]carbamimidothioate |
| SMILES | CNC(=O)C(C)Oc1cc(Oc2ccc(S(C)(=O)=O)cc2)cc(C(=O)/N=C(\N)S/C=C/N)c1 |
| InChI | InChI=1S/C21H24N4O6S2/c1-13(19(26)24-2)30-16-10-14(20(27)25-21(23)32-9-8-22)11-17(12-16)31-15-4-6-18(7-5-15)33(3,28)29/h4-13H,22H2,1-3H3,(H,24,26)(H2,23,25,27)/b9-8+ |
| InChIKey | YMSKHKXIKIVJGP-CMDGGOBGSA-N |
| XLogP | 2.01 |
| TPSA | 163.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|