C16H21NS2 — CID 142937606
4-methyl-N-(thiophen-2-ylmethyl)benzenecarbothioamide;propane (PubChem CID 142937606) has the molecular formula C16H21NS2 and a molecular weight of 291.49 g/mol. Its IUPAC name is 4-methyl-N-(thiophen-2-ylmethyl)benzenecarbothioamide;propane.
| Compound Name | 4-methyl-N-(thiophen-2-ylmethyl)benzenecarbothioamide;propane |
|---|---|
| PubChem CID | 142937606 |
| Molecular Formula | C16H21NS2 |
| Molecular Weight | 291.49 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 4-methyl-N-(thiophen-2-ylmethyl)benzenecarbothioamide;propane |
| SMILES | CCC.Cc1ccc(C(=S)NCc2cccs2)cc1 |
| InChI | InChI=1S/C13H13NS2.C3H8/c1-10-4-6-11(7-5-10)13(15)14-9-12-3-2-8-16-12;1-3-2/h2-8H,9H2,1H3,(H,14,15);3H2,1-2H3 |
| InChIKey | WZZNOQKRBXHHQD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|