C26H34N2O3 — CID 142937758
[4a-methyl-1-(4-methylphenyl)-5-(3-oxopropyl)-4,6,7,8-tetrahydrobenzo[f]indazol-5-yl] acetate;ethane (PubChem CID 142937758) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is [4a-methyl-1-(4-methylphenyl)-5-(3-oxopropyl)-4,6,7,8-tetrahydrobenzo[f]indazol-5-yl] acetate;ethane.
| Compound Name | [4a-methyl-1-(4-methylphenyl)-5-(3-oxopropyl)-4,6,7,8-tetrahydrobenzo[f]indazol-5-yl] acetate;ethane |
|---|---|
| PubChem CID | 142937758 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | [4a-methyl-1-(4-methylphenyl)-5-(3-oxopropyl)-4,6,7,8-tetrahydrobenzo[f]indazol-5-yl] acetate;ethane |
| SMILES | CC.CC(=O)OC1(CCC=O)CCCC2=Cc3c(cnn3-c3ccc(C)cc3)CC21C |
| InChI | InChI=1S/C24H28N2O3.C2H6/c1-17-7-9-21(10-8-17)26-22-14-20-6-4-11-24(12-5-13-27,29-18(2)28)23(20,3)15-19(22)16-25-26;1-2/h7-10,13-14,16H,4-6,11-12,15H2,1-3H3;1-2H3 |
| InChIKey | GWTCMEJNRZZZCO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|