C20H20N4O — CID 89128932
(1R,6R)-13-(4-methylphenyl)-2,4,13,14-tetrazapentacyclo[8.7.0.01,6.02,6.012,16]heptadeca-10,12(16),14-trien-3-one (PubChem CID 89128932) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is (1R,6R)-13-(4-methylphenyl)-2,4,13,14-tetrazapentacyclo[8.7.0.01,6.02,6.012,16]heptadeca-10,12(16),14-trien-3-one.
| Compound Name | (1R,6R)-13-(4-methylphenyl)-2,4,13,14-tetrazapentacyclo[8.7.0.01,6.02,6.012,16]heptadeca-10,12(16),14-trien-3-one |
|---|---|
| PubChem CID | 89128932 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (1R,6R)-13-(4-methylphenyl)-2,4,13,14-tetrazapentacyclo[8.7.0.01,6.02,6.012,16]heptadeca-10,12(16),14-trien-3-one |
| SMILES | Cc1ccc(-n2ncc3c2C=C2CCC[C@]45CNC(=O)N4[C@]25C3)cc1 |
| InChI | InChI=1S/C20H20N4O/c1-13-4-6-16(7-5-13)23-17-9-15-3-2-8-19-12-21-18(25)24(19)20(15,19)10-14(17)11-22-23/h4-7,9,11H,2-3,8,10,12H2,1H3,(H,21,25)/t19-,20-,24?/m1/s1 |
| InChIKey | UNUIIQHCDVBBNR-GNPFLCDCSA-N |
| XLogP | 2.82 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|