C26H40N2O3S — CID 142939761
tert-butyl 3-[1-[3-[4-(propylideneamino)-3-sulfanylphenyl]propylcarbamoyl]cyclohexyl]propanoate (PubChem CID 142939761) has the molecular formula C26H40N2O3S and a molecular weight of 460.68 g/mol. Its IUPAC name is tert-butyl 3-[1-[3-[4-(propylideneamino)-3-sulfanylphenyl]propylcarbamoyl]cyclohexyl]propanoate.
| Compound Name | tert-butyl 3-[1-[3-[4-(propylideneamino)-3-sulfanylphenyl]propylcarbamoyl]cyclohexyl]propanoate |
|---|---|
| PubChem CID | 142939761 |
| Molecular Formula | C26H40N2O3S |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | tert-butyl 3-[1-[3-[4-(propylideneamino)-3-sulfanylphenyl]propylcarbamoyl]cyclohexyl]propanoate |
| SMILES | CC/C=N/c1ccc(CCCNC(=O)C2(CCC(=O)OC(C)(C)C)CCCCC2)cc1S |
| InChI | InChI=1S/C26H40N2O3S/c1-5-17-27-21-12-11-20(19-22(21)32)10-9-18-28-24(30)26(14-7-6-8-15-26)16-13-23(29)31-25(2,3)4/h11-12,17,19,32H,5-10,13-16,18H2,1-4H3,(H,28,30)/b27-17+ |
| InChIKey | XWQHZSCQMZLQHR-WPWMEQJKSA-N |
| XLogP | 6.21 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|