C21H30ClNO4 — CID 70002458
(2S)-2-[2-[1-[3-(4-chlorophenyl)propylcarbamoyl]cyclopentyl]ethoxy]butanoic acid (PubChem CID 70002458) has the molecular formula C21H30ClNO4 and a molecular weight of 395.93 g/mol. Its IUPAC name is (2S)-2-[2-[1-[3-(4-chlorophenyl)propylcarbamoyl]cyclopentyl]ethoxy]butanoic acid.
| Compound Name | (2S)-2-[2-[1-[3-(4-chlorophenyl)propylcarbamoyl]cyclopentyl]ethoxy]butanoic acid |
|---|---|
| PubChem CID | 70002458 |
| Molecular Formula | C21H30ClNO4 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (2S)-2-[2-[1-[3-(4-chlorophenyl)propylcarbamoyl]cyclopentyl]ethoxy]butanoic acid |
| SMILES | CC[C@H](OCCC1(C(=O)NCCCc2ccc(Cl)cc2)CCCC1)C(=O)O |
| InChI | InChI=1S/C21H30ClNO4/c1-2-18(19(24)25)27-15-13-21(11-3-4-12-21)20(26)23-14-5-6-16-7-9-17(22)10-8-16/h7-10,18H,2-6,11-15H2,1H3,(H,23,26)(H,24,25)/t18-/m0/s1 |
| InChIKey | DEQZHNGNEUBSJC-SFHVURJKSA-N |
| XLogP | 4.22 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|