C13H18FN — CID 142943366
N-[(1Z,3E,6Z)-8-fluoro-3,4,7-trimethylnona-1,3,6,8-tetraenyl]methanimine (PubChem CID 142943366) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is N-[(1Z,3E,6Z)-8-fluoro-3,4,7-trimethylnona-1,3,6,8-tetraenyl]methanimine.
| Compound Name | N-[(1Z,3E,6Z)-8-fluoro-3,4,7-trimethylnona-1,3,6,8-tetraenyl]methanimine |
|---|---|
| PubChem CID | 142943366 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | N-[(1Z,3E,6Z)-8-fluoro-3,4,7-trimethylnona-1,3,6,8-tetraenyl]methanimine |
| SMILES | C=N/C=C\C(C)=C(/C)C/C=C(/C)C(=C)F |
| InChI | InChI=1S/C13H18FN/c1-10(11(2)8-9-15-5)6-7-12(3)13(4)14/h7-9H,4-6H2,1-3H3/b9-8-,11-10+,12-7- |
| InChIKey | BBPKAGLIQVFWOY-LPEAOEIESA-N |
| XLogP | 4.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|