C19H14ClN5O — CID 142948413
6-(4-chlorophenyl)-9-pyridin-4-yl-3-oxa-2,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene (PubChem CID 142948413) has the molecular formula C19H14ClN5O and a molecular weight of 363.81 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-9-pyridin-4-yl-3-oxa-2,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene.
| Compound Name | 6-(4-chlorophenyl)-9-pyridin-4-yl-3-oxa-2,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene |
|---|---|
| PubChem CID | 142948413 |
| Molecular Formula | C19H14ClN5O |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 6-(4-chlorophenyl)-9-pyridin-4-yl-3-oxa-2,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene |
| SMILES | Clc1ccc(-c2nc3c4c(noc4n2)CCCN3c2ccncc2)cc1 |
| InChI | InChI=1S/C19H14ClN5O/c20-13-5-3-12(4-6-13)17-22-18-16-15(24-26-19(16)23-17)2-1-11-25(18)14-7-9-21-10-8-14/h3-10H,1-2,11H2 |
| InChIKey | ZTFWUCBLMSJAAS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |