C15H23NO — CID 142949817
1-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methylpiperidin-4-yl]ethanone (PubChem CID 142949817) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 1-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methylpiperidin-4-yl]ethanone.
| Compound Name | 1-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methylpiperidin-4-yl]ethanone |
|---|---|
| PubChem CID | 142949817 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-methylpiperidin-4-yl]ethanone |
| SMILES | C=C/C=C\C(=C/C)C1(C(C)=O)CCN(C)CC1 |
| InChI | InChI=1S/C15H23NO/c1-5-7-8-14(6-2)15(13(3)17)9-11-16(4)12-10-15/h5-8H,1,9-12H2,2-4H3/b8-7-,14-6+ |
| InChIKey | VRRKYNMATOHVJE-FBOINPIASA-N |
| XLogP | 2.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|