C22H44N2O — CID 142950423
N-methylmethanamine;propane;1-[3-(3,4,4-trimethylcyclohexa-1,5-dien-1-yl)oxypropyl]piperidine (PubChem CID 142950423) has the molecular formula C22H44N2O and a molecular weight of 352.61 g/mol. Its IUPAC name is N-methylmethanamine;propane;1-[3-(3,4,4-trimethylcyclohexa-1,5-dien-1-yl)oxypropyl]piperidine.
| Compound Name | N-methylmethanamine;propane;1-[3-(3,4,4-trimethylcyclohexa-1,5-dien-1-yl)oxypropyl]piperidine |
|---|---|
| PubChem CID | 142950423 |
| Molecular Formula | C22H44N2O |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.35 |
| IUPAC Name | N-methylmethanamine;propane;1-[3-(3,4,4-trimethylcyclohexa-1,5-dien-1-yl)oxypropyl]piperidine |
| SMILES | CC1C=C(OCCCN2CCCCC2)C=CC1(C)C.CCC.CNC |
| InChI | InChI=1S/C17H29NO.C3H8.C2H7N/c1-15-14-16(8-9-17(15,2)3)19-13-7-12-18-10-5-4-6-11-18;2*1-3-2/h8-9,14-15H,4-7,10-13H2,1-3H3;3H2,1-2H3;3H,1-2H3 |
| InChIKey | WVXWUWZQDYBPFN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|