C23H31F2N5O5 — CID 142956056
prop-2-enyl N-[3-[(6S)-8-[(2Z,3E)-2-ethylidene-3,5-difluorohexa-3,5-dienyl]-1-formyl-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate (PubChem CID 142956056) has the molecular formula C23H31F2N5O5 and a molecular weight of 495.53 g/mol. Its IUPAC name is prop-2-enyl N-[3-[(6S)-8-[(2Z,3E)-2-ethylidene-3,5-difluorohexa-3,5-dienyl]-1-formyl-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate.
| Compound Name | prop-2-enyl N-[3-[(6S)-8-[(2Z,3E)-2-ethylidene-3,5-difluorohexa-3,5-dienyl]-1-formyl-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
|---|---|
| PubChem CID | 142956056 |
| Molecular Formula | C23H31F2N5O5 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | prop-2-enyl N-[3-[(6S)-8-[(2Z,3E)-2-ethylidene-3,5-difluorohexa-3,5-dienyl]-1-formyl-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propyl]carbamate |
| SMILES | C=CCOC(=O)NCCC[C@H]1C(=O)N(CC(=C/C)/C(F)=C\C(=C)F)CC2N1C(=O)CN(C)N2C=O |
| InChI | InChI=1S/C23H31F2N5O5/c1-5-10-35-23(34)26-9-7-8-19-22(33)28(12-17(6-2)18(25)11-16(3)24)13-20-29(15-31)27(4)14-21(32)30(19)20/h5-6,11,15,19-20H,1,3,7-10,12-14H2,2,4H3,(H,26,34)/b17-6-,18-11+/t19-,20?/m0/s1 |
| InChIKey | MBZDYBYITUOKCT-GAAQUJSOSA-N |
| XLogP | 1.65 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|