C62H71IN2O9 — CID 142961500
[4-(1-iodoethyl)benzenecarboximidoyl] 2,5-bis[9,9-bis[2-(2-methoxyethoxy)ethyl]fluoren-2-yl]benzenecarboximidate (PubChem CID 142961500) has the molecular formula C62H71IN2O9 and a molecular weight of 1115.16 g/mol. Its IUPAC name is [4-(1-iodoethyl)benzenecarboximidoyl] 2,5-bis[9,9-bis[2-(2-methoxyethoxy)ethyl]fluoren-2-yl]benzenecarboximidate.
| Compound Name | [4-(1-iodoethyl)benzenecarboximidoyl] 2,5-bis[9,9-bis[2-(2-methoxyethoxy)ethyl]fluoren-2-yl]benzenecarboximidate |
|---|---|
| PubChem CID | 142961500 |
| Molecular Formula | C62H71IN2O9 |
| Molecular Weight | 1115.16 g/mol |
| Exact Mass | 1114.42 |
| IUPAC Name | [4-(1-iodoethyl)benzenecarboximidoyl] 2,5-bis[9,9-bis[2-(2-methoxyethoxy)ethyl]fluoren-2-yl]benzenecarboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccc(C(C)I)cc1)c1cc(-c2ccc3c(c2)C(CCOCCOC)(CCOCCOC)c2ccccc2-3)ccc1-c1ccc2c(c1)C(CCOCCOC)(CCOCCOC)c1ccccc1-2 |
| InChI | InChI=1S/C62H71IN2O9/c1-43(63)44-14-16-45(17-15-44)59(64)74-60(65)54-40-46(47-19-22-52-50-10-6-8-12-55(50)61(57(52)41-47,24-28-70-36-32-66-2)25-29-71-37-33-67-3)18-21-49(54)48-20-23-53-51-11-7-9-13-56(51)62(58(53)42-48,26-30-72-38-34-68-4)27-31-73-39-35-69-5/h6-23,40-43,64-65H,24-39H2,1-5H3/b64-59+,65-60- |
| InChIKey | QZPHVRJGRDUAIK-HDSXGDJJSA-N |
| XLogP | 12.63 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1115.16 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|