C14H27NO4 — CID 142968161
ethane;(3E)-3-methoxy-2-methylidene-5-nitrohexa-3,5-dienal (PubChem CID 142968161) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is ethane;(3E)-3-methoxy-2-methylidene-5-nitrohexa-3,5-dienal.
| Compound Name | ethane;(3E)-3-methoxy-2-methylidene-5-nitrohexa-3,5-dienal |
|---|---|
| PubChem CID | 142968161 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | ethane;(3E)-3-methoxy-2-methylidene-5-nitrohexa-3,5-dienal |
| SMILES | C=C(C=O)/C(=C\C(=C)[N+](=O)[O-])OC.CC.CC.CC |
| InChI | InChI=1S/C8H9NO4.3C2H6/c1-6(5-10)8(13-3)4-7(2)9(11)12;3*1-2/h4-5H,1-2H2,3H3;3*1-2H3/b8-4+;;; |
| InChIKey | NLRGNADMOMGCCM-SJKHGNCSSA-N |
| XLogP | 4.14 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|