C15H18ClN5S — CID 142971524
(1E)-1-N'-[[4-(3-amino-4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-1-N'-methylbuta-1,3-diene-1,1,2-triamine (PubChem CID 142971524) has the molecular formula C15H18ClN5S and a molecular weight of 335.86 g/mol. Its IUPAC name is (1E)-1-N'-[[4-(3-amino-4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-1-N'-methylbuta-1,3-diene-1,1,2-triamine.
| Compound Name | (1E)-1-N'-[[4-(3-amino-4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-1-N'-methylbuta-1,3-diene-1,1,2-triamine |
|---|---|
| PubChem CID | 142971524 |
| Molecular Formula | C15H18ClN5S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (1E)-1-N'-[[4-(3-amino-4-chlorophenyl)-1,3-thiazol-2-yl]methyl]-1-N'-methylbuta-1,3-diene-1,1,2-triamine |
| SMILES | C=C/C(N)=C(/N)N(C)Cc1nc(-c2ccc(Cl)c(N)c2)cs1 |
| InChI | InChI=1S/C15H18ClN5S/c1-3-11(17)15(19)21(2)7-14-20-13(8-22-14)9-4-5-10(16)12(18)6-9/h3-6,8H,1,7,17-19H2,2H3/b15-11+ |
| InChIKey | HHORXEFPAOGFMX-RVDMUPIBSA-N |
| XLogP | 2.75 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|