C20H36N2 — CID 142974153
(Z)-6-[2-[(E)-3-methylhept-1-enyl]-6-methylidenepiperidin-1-yl]hex-4-en-1-amine (PubChem CID 142974153) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is (Z)-6-[2-[(E)-3-methylhept-1-enyl]-6-methylidenepiperidin-1-yl]hex-4-en-1-amine.
| Compound Name | (Z)-6-[2-[(E)-3-methylhept-1-enyl]-6-methylidenepiperidin-1-yl]hex-4-en-1-amine |
|---|---|
| PubChem CID | 142974153 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | (Z)-6-[2-[(E)-3-methylhept-1-enyl]-6-methylidenepiperidin-1-yl]hex-4-en-1-amine |
| SMILES | C=C1CCCC(/C=C/C(C)CCCC)N1C/C=C\CCCN |
| InChI | InChI=1S/C20H36N2/c1-4-5-11-18(2)14-15-20-13-10-12-19(3)22(20)17-9-7-6-8-16-21/h7,9,14-15,18,20H,3-6,8,10-13,16-17,21H2,1-2H3/b9-7-,15-14+ |
| InChIKey | MRKPTRXTQJXQSJ-DKWVFZHTSA-N |
| XLogP | 5.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|