C18H19FN4O — CID 142976352
N'-[(1Z,3Z)-1-amino-1-(4-fluorophenyl)-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,3,5-trien-3-yl]ethanimidamide (PubChem CID 142976352) has the molecular formula C18H19FN4O and a molecular weight of 326.38 g/mol. Its IUPAC name is N'-[(1Z,3Z)-1-amino-1-(4-fluorophenyl)-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,3,5-trien-3-yl]ethanimidamide.
| Compound Name | N'-[(1Z,3Z)-1-amino-1-(4-fluorophenyl)-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,3,5-trien-3-yl]ethanimidamide |
|---|---|
| PubChem CID | 142976352 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N'-[(1Z,3Z)-1-amino-1-(4-fluorophenyl)-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,3,5-trien-3-yl]ethanimidamide |
| SMILES | C=C/C=C(\N=C(/C)N)C(=C(/N)c1ccc(F)cc1)/N1C=COC1=C |
| InChI | InChI=1S/C18H19FN4O/c1-4-5-16(22-12(2)20)18(23-10-11-24-13(23)3)17(21)14-6-8-15(19)9-7-14/h4-11H,1,3,21H2,2H3,(H2,20,22)/b16-5-,18-17- |
| InChIKey | HYOHRWRNCVKAKU-XEGYRSSDSA-N |
| XLogP | 3.17 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|