C18H21FN4O — CID 88884998
(1Z,3Z)-1-(4-fluorophenyl)-2-(2-methyl-2H-1,3-oxazol-3-yl)-5-prop-1-en-2-yliminopenta-1,3-diene-1,3-diamine (PubChem CID 88884998) has the molecular formula C18H21FN4O and a molecular weight of 328.39 g/mol. Its IUPAC name is (1Z,3Z)-1-(4-fluorophenyl)-2-(2-methyl-2H-1,3-oxazol-3-yl)-5-prop-1-en-2-yliminopenta-1,3-diene-1,3-diamine.
| Compound Name | (1Z,3Z)-1-(4-fluorophenyl)-2-(2-methyl-2H-1,3-oxazol-3-yl)-5-prop-1-en-2-yliminopenta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 88884998 |
| Molecular Formula | C18H21FN4O |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (1Z,3Z)-1-(4-fluorophenyl)-2-(2-methyl-2H-1,3-oxazol-3-yl)-5-prop-1-en-2-yliminopenta-1,3-diene-1,3-diamine |
| SMILES | C=C(C)/N=C/C=C(N)/C(=C(/N)c1ccc(F)cc1)N1C=COC1C |
| InChI | InChI=1S/C18H21FN4O/c1-12(2)22-9-8-16(20)18(23-10-11-24-13(23)3)17(21)14-4-6-15(19)7-5-14/h4-11,13H,1,20-21H2,2-3H3/b16-8-,18-17-,22-9+ |
| InChIKey | QQLILPIDNSBNQO-YRNVZTQZSA-N |
| XLogP | 3.05 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|