About (1Z)-1-(4-fluorophenyl)-3-methyl-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,5-dien-1-amine
(1Z)-1-(4-fluorophenyl)-3-methyl-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,5-dien-1-amine (PubChem CID 89011069) has the molecular formula C17H19FN2O
and a molecular weight of 286.35 g/mol. Its IUPAC name is (1Z)-1-(4-fluorophenyl)-3-methyl-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | (1Z)-1-(4-fluorophenyl)-3-methyl-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,5-dien-1-amine |
| PubChem CID | 89011069 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | (1Z)-1-(4-fluorophenyl)-3-methyl-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,5-dien-1-amine |
| SMILES | C=CCC(C)/C(=C(/N)c1ccc(F)cc1)N1C=COC1=C |
| InChI | InChI=1S/C17H19FN2O/c1-4-5-12(2)17(20-10-11-21-13(20)3)16(19)14-6-8-15(18)9-7-14/h4,6-12H,1,3,5,19H2,2H3/b17-16- |
| InChIKey | GIWOXBZUUAUCAM-MSUUIHNZSA-N |
| XLogP | 3.94 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-(4-fluorophenyl)-3-methyl-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-(4-fluorophenyl)-3-methyl-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,5-dien-1-amine?
The IUPAC name of (1Z)-1-(4-fluorophenyl)-3-methyl-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,5-dien-1-amine (CID 89011069) is (1Z)-1-(4-fluorophenyl)-3-methyl-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,5-dien-1-amine.
What is the SMILES notation for (1Z)-1-(4-fluorophenyl)-3-methyl-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,5-dien-1-amine?
The canonical SMILES for (1Z)-1-(4-fluorophenyl)-3-methyl-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,5-dien-1-amine is C=CCC(C)/C(=C(/N)c1ccc(F)cc1)N1C=COC1=C.
What is the InChIKey of (1Z)-1-(4-fluorophenyl)-3-methyl-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,5-dien-1-amine?
The InChIKey is GIWOXBZUUAUCAM-MSUUIHNZSA-N. The full InChI is InChI=1S/C17H19FN2O/c1-4-5-12(2)17(20-10-11-21-13(20)3)16(19)14-6-8-15(18)9-7-14/h4,6-12H,1,3,5,19H2,2H3/b17-16-.
What are the key properties of (1Z)-1-(4-fluorophenyl)-3-methyl-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,5-dien-1-amine?
(1Z)-1-(4-fluorophenyl)-3-methyl-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,5-dien-1-amine has a molecular weight of 286.35 g/mol, XLogP of 3.94, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-(4-fluorophenyl)-3-methyl-2-(2-methylidene-1,3-oxazol-3-yl)hexa-1,5-dien-1-amine is sourced from PubChem (CID 89011069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).