C21H17F6N3O3 — CID 142981464
3-[(Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-3-phenylprop-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 142981464) has the molecular formula C21H17F6N3O3 and a molecular weight of 473.37 g/mol. Its IUPAC name is 3-[(Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-3-phenylprop-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-3-phenylprop-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142981464 |
| Molecular Formula | C21H17F6N3O3 |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 3-[(Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-3-phenylprop-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | N/C(C(=O)N1CCOC1=O)=C(\NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C21H17F6N3O3/c22-20(23,24)14-8-12(9-15(10-14)21(25,26)27)11-29-17(13-4-2-1-3-5-13)16(28)18(31)30-6-7-33-19(30)32/h1-5,8-10,29H,6-7,11,28H2/b17-16- |
| InChIKey | HZRDFFZHTKDYHZ-MSUUIHNZSA-N |
| XLogP | 4.12 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|