C28H32N2O — CID 142982042
2-[4-[(E)-C-(3,5,5,8,8-pentamethylnaphthalen-2-yl)carbonohydrazonoyl]phenyl]cyclohex-2-en-1-one (PubChem CID 142982042) has the molecular formula C28H32N2O and a molecular weight of 412.58 g/mol. Its IUPAC name is 2-[4-[(E)-C-(3,5,5,8,8-pentamethylnaphthalen-2-yl)carbonohydrazonoyl]phenyl]cyclohex-2-en-1-one.
| Compound Name | 2-[4-[(E)-C-(3,5,5,8,8-pentamethylnaphthalen-2-yl)carbonohydrazonoyl]phenyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 142982042 |
| Molecular Formula | C28H32N2O |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 2-[4-[(E)-C-(3,5,5,8,8-pentamethylnaphthalen-2-yl)carbonohydrazonoyl]phenyl]cyclohex-2-en-1-one |
| SMILES | Cc1cc2c(cc1/C(=N/N)c1ccc(C3=CCCCC3=O)cc1)C(C)(C)C=CC2(C)C |
| InChI | InChI=1S/C28H32N2O/c1-18-16-23-24(28(4,5)15-14-27(23,2)3)17-22(18)26(30-29)20-12-10-19(11-13-20)21-8-6-7-9-25(21)31/h8,10-17H,6-7,9,29H2,1-5H3/b30-26+ |
| InChIKey | JQMOQMADMHUSGJ-URGPHPNLSA-N |
| XLogP | 5.97 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|