C28H36N2O — CID 142982044
ethane;2-[4-[(E)-C-(3,5,8,8-tetramethyl-6,7-dihydro-5H-naphthalen-2-yl)carbonohydrazonoyl]phenyl]cyclopent-2-en-1-one (PubChem CID 142982044) has the molecular formula C28H36N2O and a molecular weight of 416.61 g/mol. Its IUPAC name is ethane;2-[4-[(E)-C-(3,5,8,8-tetramethyl-6,7-dihydro-5H-naphthalen-2-yl)carbonohydrazonoyl]phenyl]cyclopent-2-en-1-one.
| Compound Name | ethane;2-[4-[(E)-C-(3,5,8,8-tetramethyl-6,7-dihydro-5H-naphthalen-2-yl)carbonohydrazonoyl]phenyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 142982044 |
| Molecular Formula | C28H36N2O |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | ethane;2-[4-[(E)-C-(3,5,8,8-tetramethyl-6,7-dihydro-5H-naphthalen-2-yl)carbonohydrazonoyl]phenyl]cyclopent-2-en-1-one |
| SMILES | CC.Cc1cc2c(cc1/C(=N/N)c1ccc(C3=CCCC3=O)cc1)C(C)(C)CCC2C |
| InChI | InChI=1S/C26H30N2O.C2H6/c1-16-12-13-26(3,4)23-15-22(17(2)14-21(16)23)25(28-27)19-10-8-18(9-11-19)20-6-5-7-24(20)29;1-2/h6,8-11,14-16H,5,7,12-13,27H2,1-4H3;1-2H3/b28-25+; |
| InChIKey | WRAGHXPWGCRIIV-KZAGWHOFSA-N |
| XLogP | 6.65 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|