C23H29F4N3O2 — CID 142983635
2-[[2-[(Z)-(dimethylhydrazinylidene)methyl]anilino]methyl]-1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-4-methylpentan-2-ol (PubChem CID 142983635) has the molecular formula C23H29F4N3O2 and a molecular weight of 455.50 g/mol. Its IUPAC name is 2-[[2-[(Z)-(dimethylhydrazinylidene)methyl]anilino]methyl]-1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-4-methylpentan-2-ol.
| Compound Name | 2-[[2-[(Z)-(dimethylhydrazinylidene)methyl]anilino]methyl]-1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 142983635 |
| Molecular Formula | C23H29F4N3O2 |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-[[2-[(Z)-(dimethylhydrazinylidene)methyl]anilino]methyl]-1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-4-methylpentan-2-ol |
| SMILES | COc1ccc(F)cc1C(C)(C)CC(O)(CNc1ccccc1/C=N\N(C)C)C(F)(F)F |
| InChI | InChI=1S/C23H29F4N3O2/c1-21(2,18-12-17(24)10-11-20(18)32-5)14-22(31,23(25,26)27)15-28-19-9-7-6-8-16(19)13-29-30(3)4/h6-13,28,31H,14-15H2,1-5H3/b29-13- |
| InChIKey | FBZSNFRVIBFYMF-DBFSUHOCSA-N |
| XLogP | 4.80 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|