C22H31ClF2N2O2 — CID 142984555
2-(2-chloro-4-methylanilino)-3,4-difluorobenzaldehyde;ethane;N-(2-methylbutoxy)methanamine (PubChem CID 142984555) has the molecular formula C22H31ClF2N2O2 and a molecular weight of 428.95 g/mol. Its IUPAC name is 2-(2-chloro-4-methylanilino)-3,4-difluorobenzaldehyde;ethane;N-(2-methylbutoxy)methanamine.
| Compound Name | 2-(2-chloro-4-methylanilino)-3,4-difluorobenzaldehyde;ethane;N-(2-methylbutoxy)methanamine |
|---|---|
| PubChem CID | 142984555 |
| Molecular Formula | C22H31ClF2N2O2 |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-(2-chloro-4-methylanilino)-3,4-difluorobenzaldehyde;ethane;N-(2-methylbutoxy)methanamine |
| SMILES | CC.CCC(C)CONC.Cc1ccc(Nc2c(C=O)ccc(F)c2F)c(Cl)c1 |
| InChI | InChI=1S/C14H10ClF2NO.C6H15NO.C2H6/c1-8-2-5-12(10(15)6-8)18-14-9(7-19)3-4-11(16)13(14)17;1-4-6(2)5-8-7-3;1-2/h2-7,18H,1H3;6-7H,4-5H2,1-3H3;1-2H3 |
| InChIKey | OVCCNNJDNORTGX-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|