C20H22F3NO2 — CID 143173046
5-(2,2-dimethylpropoxymethyl)-3,4-difluoro-2-(2-fluoro-4-methylanilino)benzaldehyde (PubChem CID 143173046) has the molecular formula C20H22F3NO2 and a molecular weight of 365.40 g/mol. Its IUPAC name is 5-(2,2-dimethylpropoxymethyl)-3,4-difluoro-2-(2-fluoro-4-methylanilino)benzaldehyde.
| Compound Name | 5-(2,2-dimethylpropoxymethyl)-3,4-difluoro-2-(2-fluoro-4-methylanilino)benzaldehyde |
|---|---|
| PubChem CID | 143173046 |
| Molecular Formula | C20H22F3NO2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 5-(2,2-dimethylpropoxymethyl)-3,4-difluoro-2-(2-fluoro-4-methylanilino)benzaldehyde |
| SMILES | Cc1ccc(Nc2c(C=O)cc(COCC(C)(C)C)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C20H22F3NO2/c1-12-5-6-16(15(21)7-12)24-19-13(9-25)8-14(17(22)18(19)23)10-26-11-20(2,3)4/h5-9,24H,10-11H2,1-4H3 |
| InChIKey | GLUNBDDRWROLOB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|