C21H18N2O3S — CID 142992017
3-[4-(2-hydroxy-4-methoxyphenyl)phenyl]-3-oxo-N-pyridin-2-ylpropanethioamide (PubChem CID 142992017) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-[4-(2-hydroxy-4-methoxyphenyl)phenyl]-3-oxo-N-pyridin-2-ylpropanethioamide.
| Compound Name | 3-[4-(2-hydroxy-4-methoxyphenyl)phenyl]-3-oxo-N-pyridin-2-ylpropanethioamide |
|---|---|
| PubChem CID | 142992017 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 3-[4-(2-hydroxy-4-methoxyphenyl)phenyl]-3-oxo-N-pyridin-2-ylpropanethioamide |
| SMILES | COc1ccc(-c2ccc(C(=O)CC(=S)Nc3ccccn3)cc2)c(O)c1 |
| InChI | InChI=1S/C21H18N2O3S/c1-26-16-9-10-17(19(25)12-16)14-5-7-15(8-6-14)18(24)13-21(27)23-20-4-2-3-11-22-20/h2-12,25H,13H2,1H3,(H,22,23,27) |
| InChIKey | IVWRYUOCXKSDJJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|