C7H8N2S — CID 142994318
1,3-dihydro-2,1-benzothiazol-6-amine (PubChem CID 142994318) has the molecular formula C7H8N2S and a molecular weight of 152.22 g/mol. Its IUPAC name is 1,3-dihydro-2,1-benzothiazol-6-amine.
| Compound Name | 1,3-dihydro-2,1-benzothiazol-6-amine |
|---|---|
| PubChem CID | 142994318 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 1,3-dihydro-2,1-benzothiazol-6-amine |
| SMILES | Nc1ccc2c(c1)NSC2 |
| InChI | InChI=1S/C7H8N2S/c8-6-2-1-5-4-10-9-7(5)3-6/h1-3,9H,4,8H2 |
| InChIKey | JSGNSTRCOSZQAO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|