C24H41NO3 — CID 142997628
1-[7-hydroxy-7-[(2-methoxyethylamino)methyl]-1,2,4b-trimethyl-3,4,4a,5,6,8,10,10a-octahydro-1H-phenanthren-2-yl]propan-1-one (PubChem CID 142997628) has the molecular formula C24H41NO3 and a molecular weight of 391.60 g/mol. Its IUPAC name is 1-[7-hydroxy-7-[(2-methoxyethylamino)methyl]-1,2,4b-trimethyl-3,4,4a,5,6,8,10,10a-octahydro-1H-phenanthren-2-yl]propan-1-one.
| Compound Name | 1-[7-hydroxy-7-[(2-methoxyethylamino)methyl]-1,2,4b-trimethyl-3,4,4a,5,6,8,10,10a-octahydro-1H-phenanthren-2-yl]propan-1-one |
|---|---|
| PubChem CID | 142997628 |
| Molecular Formula | C24H41NO3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | 1-[7-hydroxy-7-[(2-methoxyethylamino)methyl]-1,2,4b-trimethyl-3,4,4a,5,6,8,10,10a-octahydro-1H-phenanthren-2-yl]propan-1-one |
| SMILES | CCC(=O)C1(C)CCC2C(CC=C3CC(O)(CNCCOC)CCC32C)C1C |
| InChI | InChI=1S/C24H41NO3/c1-6-21(26)22(3)10-9-20-19(17(22)2)8-7-18-15-24(27,12-11-23(18,20)4)16-25-13-14-28-5/h7,17,19-20,25,27H,6,8-16H2,1-5H3 |
| InChIKey | PRMCNEVTDAFMPS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|