C11H14Cl2N2 — CID 143002594
(3E)-1,4-dichloro-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]buta-1,3-diene-1,4-diamine (PubChem CID 143002594) has the molecular formula C11H14Cl2N2 and a molecular weight of 245.15 g/mol. Its IUPAC name is (3E)-1,4-dichloro-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]buta-1,3-diene-1,4-diamine.
| Compound Name | (3E)-1,4-dichloro-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]buta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 143002594 |
| Molecular Formula | C11H14Cl2N2 |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (3E)-1,4-dichloro-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]buta-1,3-diene-1,4-diamine |
| SMILES | C=C/C=C\C(=C/C)C(/C=C(\N)Cl)=C(N)Cl |
| InChI | InChI=1S/C11H14Cl2N2/c1-3-5-6-8(4-2)9(11(13)15)7-10(12)14/h3-7H,1,14-15H2,2H3/b6-5-,8-4+,10-7-,11-9? |
| InChIKey | RBQCBUQGMFFZIU-QJMRUKDQSA-N |
| XLogP | 3.12 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|