C26H34N6O3S — CID 143003263
2-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-5-methyl-4-N-[2-(methylaminosulfanyl)phenyl]pyrimidine-2,4-diamine (PubChem CID 143003263) has the molecular formula C26H34N6O3S and a molecular weight of 510.66 g/mol. Its IUPAC name is 2-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-5-methyl-4-N-[2-(methylaminosulfanyl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-5-methyl-4-N-[2-(methylaminosulfanyl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143003263 |
| Molecular Formula | C26H34N6O3S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 2-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-5-methyl-4-N-[2-(methylaminosulfanyl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1Nc1ncc(C)c(Nc2ccccc2SNC)n1 |
| InChI | InChI=1S/C26H34N6O3S/c1-5-34-22-16-21(32-11-13-33-14-12-32)23(35-6-2)15-20(22)30-26-28-17-18(3)25(31-26)29-19-9-7-8-10-24(19)36-27-4/h7-10,15-17,27H,5-6,11-14H2,1-4H3,(H2,28,29,30,31) |
| InChIKey | DUQOXKFPDCMSGP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 92.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|