C25H32N4O3 — CID 21003902
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-propan-2-ylquinazolin-4-amine (PubChem CID 21003902) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-propan-2-ylquinazolin-4-amine.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-propan-2-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 21003902 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-propan-2-ylquinazolin-4-amine |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1Nc1nc(C(C)C)nc2ccccc12 |
| InChI | InChI=1S/C25H32N4O3/c1-5-31-22-16-21(29-11-13-30-14-12-29)23(32-6-2)15-20(22)27-25-18-9-7-8-10-19(18)26-24(28-25)17(3)4/h7-10,15-17H,5-6,11-14H2,1-4H3,(H,26,27,28) |
| InChIKey | UZRWSFCHFDNWJA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|