C19H32N2O4 — CID 143006398
(5aS,9aS)-2-butan-2-yl-3-methyl-5a,6,7,8,9,9a,10,10a-octahydro-3H-pyrazino[1,2-a]indole-1,4-dione;ethyl formate (PubChem CID 143006398) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is (5aS,9aS)-2-butan-2-yl-3-methyl-5a,6,7,8,9,9a,10,10a-octahydro-3H-pyrazino[1,2-a]indole-1,4-dione;ethyl formate.
| Compound Name | (5aS,9aS)-2-butan-2-yl-3-methyl-5a,6,7,8,9,9a,10,10a-octahydro-3H-pyrazino[1,2-a]indole-1,4-dione;ethyl formate |
|---|---|
| PubChem CID | 143006398 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (5aS,9aS)-2-butan-2-yl-3-methyl-5a,6,7,8,9,9a,10,10a-octahydro-3H-pyrazino[1,2-a]indole-1,4-dione;ethyl formate |
| SMILES | CCC(C)N1C(=O)C2C[C@@H]3CCCC[C@@H]3N2C(=O)C1C.CCOC=O |
| InChI | InChI=1S/C16H26N2O2.C3H6O2/c1-4-10(2)17-11(3)15(19)18-13-8-6-5-7-12(13)9-14(18)16(17)20;1-2-5-3-4/h10-14H,4-9H2,1-3H3;3H,2H2,1H3/t10?,11?,12-,13-,14?;/m0./s1 |
| InChIKey | RELOBRFISRZLLY-RJXDVLFRSA-N |
| XLogP | 2.35 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|