C26H42O2 — CID 143014807
2-[(1S,7aR)-7a-methyl-1-(5-methylhexyl)-5-(1-methyl-2-oxocyclohex-3-en-1-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]acetaldehyde (PubChem CID 143014807) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is 2-[(1S,7aR)-7a-methyl-1-(5-methylhexyl)-5-(1-methyl-2-oxocyclohex-3-en-1-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]acetaldehyde.
| Compound Name | 2-[(1S,7aR)-7a-methyl-1-(5-methylhexyl)-5-(1-methyl-2-oxocyclohex-3-en-1-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 143014807 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | 2-[(1S,7aR)-7a-methyl-1-(5-methylhexyl)-5-(1-methyl-2-oxocyclohex-3-en-1-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]acetaldehyde |
| SMILES | CC(C)CCCC[C@H]1CCC2C(CC=O)C(C3(C)CCC=CC3=O)CC[C@@]21C |
| InChI | InChI=1S/C26H42O2/c1-19(2)9-5-6-10-20-12-13-22-21(15-18-27)23(14-17-25(20,22)3)26(4)16-8-7-11-24(26)28/h7,11,18-23H,5-6,8-10,12-17H2,1-4H3/t20-,21?,22?,23?,25+,26?/m0/s1 |
| InChIKey | CCUGRYQXHPZULD-TULIIEOZSA-N |
| XLogP | 6.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|