C12H19N5OS — CID 143017097
N-cyclobutyl-N-methyl-2-[(pyrazin-2-ylamino)sulfanylmethylamino]acetamide (PubChem CID 143017097) has the molecular formula C12H19N5OS and a molecular weight of 281.38 g/mol. Its IUPAC name is N-cyclobutyl-N-methyl-2-[(pyrazin-2-ylamino)sulfanylmethylamino]acetamide.
| Compound Name | N-cyclobutyl-N-methyl-2-[(pyrazin-2-ylamino)sulfanylmethylamino]acetamide |
|---|---|
| PubChem CID | 143017097 |
| Molecular Formula | C12H19N5OS |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | N-cyclobutyl-N-methyl-2-[(pyrazin-2-ylamino)sulfanylmethylamino]acetamide |
| SMILES | CN(C(=O)CNCSNc1cnccn1)C1CCC1 |
| InChI | InChI=1S/C12H19N5OS/c1-17(10-3-2-4-10)12(18)8-14-9-19-16-11-7-13-5-6-15-11/h5-7,10,14H,2-4,8-9H2,1H3,(H,15,16) |
| InChIKey | SFOAZOMMQKOJCP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|