C14H21N5O2 — CID 87740588
N-[[4-methyl-1-[(pyrazin-2-ylamino)carbamoyl]cyclohexyl]methyl]formamide (PubChem CID 87740588) has the molecular formula C14H21N5O2 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[[4-methyl-1-[(pyrazin-2-ylamino)carbamoyl]cyclohexyl]methyl]formamide.
| Compound Name | N-[[4-methyl-1-[(pyrazin-2-ylamino)carbamoyl]cyclohexyl]methyl]formamide |
|---|---|
| PubChem CID | 87740588 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-[[4-methyl-1-[(pyrazin-2-ylamino)carbamoyl]cyclohexyl]methyl]formamide |
| SMILES | CC1CCC(CNC=O)(C(=O)NNc2cnccn2)CC1 |
| InChI | InChI=1S/C14H21N5O2/c1-11-2-4-14(5-3-11,9-16-10-20)13(21)19-18-12-8-15-6-7-17-12/h6-8,10-11H,2-5,9H2,1H3,(H,16,20)(H,17,18)(H,19,21) |
| InChIKey | LFWRCGUQTAYWJX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|