C28H39N3O7 — CID 143018628
methyl (1S)-1-[[(2S,4S)-1-[(2S)-2-(cyclopentyloxycarbonylamino)non-8-enoyl]-4-hydroxypyrrolidine-2-carbonyl]iminomethyl]-2-ethenylidenecyclopropane-1-carboxylate (PubChem CID 143018628) has the molecular formula C28H39N3O7 and a molecular weight of 529.63 g/mol. Its IUPAC name is methyl (1S)-1-[[(2S,4S)-1-[(2S)-2-(cyclopentyloxycarbonylamino)non-8-enoyl]-4-hydroxypyrrolidine-2-carbonyl]iminomethyl]-2-ethenylidenecyclopropane-1-carboxylate.
| Compound Name | methyl (1S)-1-[[(2S,4S)-1-[(2S)-2-(cyclopentyloxycarbonylamino)non-8-enoyl]-4-hydroxypyrrolidine-2-carbonyl]iminomethyl]-2-ethenylidenecyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 143018628 |
| Molecular Formula | C28H39N3O7 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | methyl (1S)-1-[[(2S,4S)-1-[(2S)-2-(cyclopentyloxycarbonylamino)non-8-enoyl]-4-hydroxypyrrolidine-2-carbonyl]iminomethyl]-2-ethenylidenecyclopropane-1-carboxylate |
| SMILES | C=C=C1C[C@]1(/C=N/C(=O)[C@@H]1C[C@H](O)CN1C(=O)[C@H](CCCCCC=C)NC(=O)OC1CCCC1)C(=O)OC |
| InChI | InChI=1S/C28H39N3O7/c1-4-6-7-8-9-14-22(30-27(36)38-21-12-10-11-13-21)25(34)31-17-20(32)15-23(31)24(33)29-18-28(26(35)37-3)16-19(28)5-2/h4,18,20-23,32H,1-2,6-17H2,3H3,(H,30,36)/b29-18+/t20-,22-,23-,28+/m0/s1 |
| InChIKey | ZHHDGOMRZHMGGI-NAYSGQNHSA-N |
| XLogP | 2.99 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|