C21H20Cl2N4O2S — CID 143028842
4-[4-[(3,4-dichloroanilino)methylsulfanyl]-3-(methylamino)phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 143028842) has the molecular formula C21H20Cl2N4O2S and a molecular weight of 463.39 g/mol. Its IUPAC name is 4-[4-[(3,4-dichloroanilino)methylsulfanyl]-3-(methylamino)phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-[(3,4-dichloroanilino)methylsulfanyl]-3-(methylamino)phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 143028842 |
| Molecular Formula | C21H20Cl2N4O2S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 4-[4-[(3,4-dichloroanilino)methylsulfanyl]-3-(methylamino)phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(SCNc3ccc(Cl)c(Cl)c3)c(NC)c2)ccn1 |
| InChI | InChI=1S/C21H20Cl2N4O2S/c1-24-18-10-14(29-15-7-8-26-19(11-15)21(28)25-2)4-6-20(18)30-12-27-13-3-5-16(22)17(23)9-13/h3-11,24,27H,12H2,1-2H3,(H,25,28) |
| InChIKey | WUNWZAONIWFYIB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|