C28H30N2O2S — CID 143033279
5-[3-[[benzyl(2-phenylethyl)amino]methyl]phenyl]thiophene-2-carbaldehyde;N-methylhydroxylamine (PubChem CID 143033279) has the molecular formula C28H30N2O2S and a molecular weight of 458.63 g/mol. Its IUPAC name is 5-[3-[[benzyl(2-phenylethyl)amino]methyl]phenyl]thiophene-2-carbaldehyde;N-methylhydroxylamine.
| Compound Name | 5-[3-[[benzyl(2-phenylethyl)amino]methyl]phenyl]thiophene-2-carbaldehyde;N-methylhydroxylamine |
|---|---|
| PubChem CID | 143033279 |
| Molecular Formula | C28H30N2O2S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 5-[3-[[benzyl(2-phenylethyl)amino]methyl]phenyl]thiophene-2-carbaldehyde;N-methylhydroxylamine |
| SMILES | CNO.O=Cc1ccc(-c2cccc(CN(CCc3ccccc3)Cc3ccccc3)c2)s1 |
| InChI | InChI=1S/C27H25NOS.CH5NO/c29-21-26-14-15-27(30-26)25-13-7-12-24(18-25)20-28(19-23-10-5-2-6-11-23)17-16-22-8-3-1-4-9-22;1-2-3/h1-15,18,21H,16-17,19-20H2;2-3H,1H3 |
| InChIKey | GEJKBLTUKOPDLF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|