C26H35N3O2S — CID 143040071
5-[4-[[2-(diethylamino)ethyl-(2-phenylethyl)amino]methyl]phenyl]thiophene-2-carbaldehyde;hydroxylamine (PubChem CID 143040071) has the molecular formula C26H35N3O2S and a molecular weight of 453.65 g/mol. Its IUPAC name is 5-[4-[[2-(diethylamino)ethyl-(2-phenylethyl)amino]methyl]phenyl]thiophene-2-carbaldehyde;hydroxylamine.
| Compound Name | 5-[4-[[2-(diethylamino)ethyl-(2-phenylethyl)amino]methyl]phenyl]thiophene-2-carbaldehyde;hydroxylamine |
|---|---|
| PubChem CID | 143040071 |
| Molecular Formula | C26H35N3O2S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 5-[4-[[2-(diethylamino)ethyl-(2-phenylethyl)amino]methyl]phenyl]thiophene-2-carbaldehyde;hydroxylamine |
| SMILES | CCN(CC)CCN(CCc1ccccc1)Cc1ccc(-c2ccc(C=O)s2)cc1.NO |
| InChI | InChI=1S/C26H32N2OS.H3NO/c1-3-27(4-2)18-19-28(17-16-22-8-6-5-7-9-22)20-23-10-12-24(13-11-23)26-15-14-25(21-29)30-26;1-2/h5-15,21H,3-4,16-20H2,1-2H3;2H,1H2 |
| InChIKey | BATZXHIOHRQROH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|