C15H31N5O3 — CID 143048226
(4E)-4-hydroxyimino-5-[3-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propylamino]-5-methylhexanamide (PubChem CID 143048226) has the molecular formula C15H31N5O3 and a molecular weight of 329.45 g/mol. Its IUPAC name is (4E)-4-hydroxyimino-5-[3-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propylamino]-5-methylhexanamide.
| Compound Name | (4E)-4-hydroxyimino-5-[3-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propylamino]-5-methylhexanamide |
|---|---|
| PubChem CID | 143048226 |
| Molecular Formula | C15H31N5O3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | (4E)-4-hydroxyimino-5-[3-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propylamino]-5-methylhexanamide |
| SMILES | C/C(=N\O)C(C)(C)NCCCNC(C)(C)/C(CCC(N)=O)=N/O |
| InChI | InChI=1S/C15H31N5O3/c1-11(19-22)14(2,3)17-9-6-10-18-15(4,5)12(20-23)7-8-13(16)21/h17-18,22-23H,6-10H2,1-5H3,(H2,16,21)/b19-11+,20-12+ |
| InChIKey | GSUBYKGFVWISKR-AYKLPDECSA-N |
| XLogP | 1.06 |
| TPSA | 132.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|