C14H31N5O2 — CID 88571969
(NE)-N-[3-[[3-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]-2-(methylamino)propyl]amino]-3-methylbutan-2-ylidene]hydroxylamine (PubChem CID 88571969) has the molecular formula C14H31N5O2 and a molecular weight of 301.44 g/mol. Its IUPAC name is (NE)-N-[3-[[3-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]-2-(methylamino)propyl]amino]-3-methylbutan-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[3-[[3-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]-2-(methylamino)propyl]amino]-3-methylbutan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 88571969 |
| Molecular Formula | C14H31N5O2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | (NE)-N-[3-[[3-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]-2-(methylamino)propyl]amino]-3-methylbutan-2-ylidene]hydroxylamine |
| SMILES | CNC(CNC(C)(C)/C(C)=N/O)CNC(C)(C)/C(C)=N/O |
| InChI | InChI=1S/C14H31N5O2/c1-10(18-20)13(3,4)16-8-12(15-7)9-17-14(5,6)11(2)19-21/h12,15-17,20-21H,8-9H2,1-7H3/b18-10+,19-11+ |
| InChIKey | OZFRADGHJJSSLH-XOBNHNQQSA-N |
| XLogP | 1.01 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|