C15H30N4O3 — CID 143527571
(4E)-4-hydroxyimino-5-[3-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propylamino]-5-methylhexanal (PubChem CID 143527571) has the molecular formula C15H30N4O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (4E)-4-hydroxyimino-5-[3-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propylamino]-5-methylhexanal.
| Compound Name | (4E)-4-hydroxyimino-5-[3-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propylamino]-5-methylhexanal |
|---|---|
| PubChem CID | 143527571 |
| Molecular Formula | C15H30N4O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | (4E)-4-hydroxyimino-5-[3-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propylamino]-5-methylhexanal |
| SMILES | C/C(=N\O)C(C)(C)NCCCNC(C)(C)/C(CCC=O)=N/O |
| InChI | InChI=1S/C15H30N4O3/c1-12(18-21)14(2,3)16-9-7-10-17-15(4,5)13(19-22)8-6-11-20/h11,16-17,21-22H,6-10H2,1-5H3/b18-12+,19-13+ |
| InChIKey | ZYZRNNDVOGMUNG-KLCVKJMQSA-N |
| XLogP | 1.77 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|