C19H39N3O2 — CID 159545234
N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine (PubChem CID 159545234) has the molecular formula C19H39N3O2 and a molecular weight of 341.54 g/mol. Its IUPAC name is N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine.
| Compound Name | N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 159545234 |
| Molecular Formula | C19H39N3O2 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.30 |
| IUPAC Name | N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine |
| SMILES | CCCC(CCCC(C)(C)C(C)=NO)CCNC(C)(C)C(C)=NO |
| InChI | InChI=1S/C19H39N3O2/c1-8-10-17(11-9-13-18(4,5)15(2)21-23)12-14-20-19(6,7)16(3)22-24/h17,20,23-24H,8-14H2,1-7H3 |
| InChIKey | PVTPJCMQRURIIZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|