About N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine
N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine (PubChem CID 159545234) has the molecular formula C19H39N3O2
and a molecular weight of 341.54 g/mol. Its IUPAC name is N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine |
| PubChem CID | 159545234 |
| Molecular Formula | C19H39N3O2 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.30 |
| IUPAC Name | N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine |
| SMILES | CCCC(CCCC(C)(C)C(C)=NO)CCNC(C)(C)C(C)=NO |
| InChI | InChI=1S/C19H39N3O2/c1-8-10-17(11-9-13-18(4,5)15(2)21-23)12-14-20-19(6,7)16(3)22-24/h17,20,23-24H,8-14H2,1-7H3 |
| InChIKey | PVTPJCMQRURIIZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine?
The IUPAC name of N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine (CID 159545234) is N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine.
What is the SMILES notation for N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine?
The canonical SMILES for N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine is CCCC(CCCC(C)(C)C(C)=NO)CCNC(C)(C)C(C)=NO.
What is the InChIKey of N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine?
The InChIKey is PVTPJCMQRURIIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39N3O2/c1-8-10-17(11-9-13-18(4,5)15(2)21-23)12-14-20-19(6,7)16(3)22-24/h17,20,23-24H,8-14H2,1-7H3.
What are the key properties of N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine?
N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine has a molecular weight of 341.54 g/mol, XLogP of 5.06, 12 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(8-hydroxyimino-7,7-dimethyl-3-propylnonyl)amino]-3-methylbutan-2-ylidene]hydroxylamine is sourced from PubChem (CID 159545234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).