C14H31ClN4O2 — CID 163408611
N-[3-[4-[(3-hydroxyimino-2-methylbutan-2-yl)amino]butylamino]-3-methylbutan-2-ylidene]hydroxylamine;hydrochloride (PubChem CID 163408611) has the molecular formula C14H31ClN4O2 and a molecular weight of 322.88 g/mol. Its IUPAC name is N-[3-[4-[(3-hydroxyimino-2-methylbutan-2-yl)amino]butylamino]-3-methylbutan-2-ylidene]hydroxylamine;hydrochloride.
| Compound Name | N-[3-[4-[(3-hydroxyimino-2-methylbutan-2-yl)amino]butylamino]-3-methylbutan-2-ylidene]hydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 163408611 |
| Molecular Formula | C14H31ClN4O2 |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | N-[3-[4-[(3-hydroxyimino-2-methylbutan-2-yl)amino]butylamino]-3-methylbutan-2-ylidene]hydroxylamine;hydrochloride |
| SMILES | CC(=NO)C(C)(C)NCCCCNC(C)(C)C(C)=NO.Cl |
| InChI | InChI=1S/C14H30N4O2.ClH/c1-11(17-19)13(3,4)15-9-7-8-10-16-14(5,6)12(2)18-20;/h15-16,19-20H,7-10H2,1-6H3;1H |
| InChIKey | YUGWLDHLYAPTKC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|