C21H35N5O5S — CID 73334893
4-formyl-N,N-bis[2-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 73334893) has the molecular formula C21H35N5O5S and a molecular weight of 469.61 g/mol. Its IUPAC name is 4-formyl-N,N-bis[2-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-formyl-N,N-bis[2-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 73334893 |
| Molecular Formula | C21H35N5O5S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 4-formyl-N,N-bis[2-[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | C/C(=N\O)C(C)(C)NCCN(CCNC(C)(C)/C(C)=N/O)S(=O)(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C21H35N5O5S/c1-16(24-28)20(3,4)22-11-13-26(14-12-23-21(5,6)17(2)25-29)32(30,31)19-9-7-18(15-27)8-10-19/h7-10,15,22-23,28-29H,11-14H2,1-6H3/b24-16+,25-17+ |
| InChIKey | FAMXZOGUPUGBHS-MUPYBJATSA-N |
| XLogP | 1.93 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|