C17H19ClN2O2S — CID 5183188
4-[(4-chlorophenyl)methylideneamino]-N,N-diethylbenzenesulfonamide (PubChem CID 5183188) has the molecular formula C17H19ClN2O2S and a molecular weight of 350.87 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methylideneamino]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[(4-chlorophenyl)methylideneamino]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 5183188 |
| Molecular Formula | C17H19ClN2O2S |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-[(4-chlorophenyl)methylideneamino]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/N=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H19ClN2O2S/c1-3-20(4-2)23(21,22)17-11-9-16(10-12-17)19-13-14-5-7-15(18)8-6-14/h5-13H,3-4H2,1-2H3/b19-13+ |
| InChIKey | VRMIGYNUEIXUPW-CPNJWEJPSA-N |
| XLogP | 4.12 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|