C19H24N2O2S — CID 23882965
4-[(2,5-dimethylphenyl)methylideneamino]-N,N-diethylbenzenesulfonamide (PubChem CID 23882965) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)methylideneamino]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[(2,5-dimethylphenyl)methylideneamino]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 23882965 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)methylideneamino]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/N=C/c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C19H24N2O2S/c1-5-21(6-2)24(22,23)19-11-9-18(10-12-19)20-14-17-13-15(3)7-8-16(17)4/h7-14H,5-6H2,1-4H3/b20-14+ |
| InChIKey | IWFBMGVUMYGBLX-XSFVSMFZSA-N |
| XLogP | 4.08 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|