C16H19FN4O3 — CID 143049284
6-[2-[(5-fluoro-2-pyridinyl)oxy]ethoxy]-4-morpholin-4-ylpyridin-2-amine (PubChem CID 143049284) has the molecular formula C16H19FN4O3 and a molecular weight of 334.35 g/mol. Its IUPAC name is 6-[2-[(5-fluoro-2-pyridinyl)oxy]ethoxy]-4-morpholin-4-ylpyridin-2-amine.
| Compound Name | 6-[2-[(5-fluoro-2-pyridinyl)oxy]ethoxy]-4-morpholin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 143049284 |
| Molecular Formula | C16H19FN4O3 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 6-[2-[(5-fluoro-2-pyridinyl)oxy]ethoxy]-4-morpholin-4-ylpyridin-2-amine |
| SMILES | Nc1cc(N2CCOCC2)cc(OCCOc2ccc(F)cn2)n1 |
| InChI | InChI=1S/C16H19FN4O3/c17-12-1-2-15(19-11-12)23-7-8-24-16-10-13(9-14(18)20-16)21-3-5-22-6-4-21/h1-2,9-11H,3-8H2,(H2,18,20) |
| InChIKey | UUTKUJUVDONJIO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 82.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|